![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| BrooksDelNegrowebappendix.pdf | 04-Mar-2006 20:31 | 86K | |
| Croson-Gomes-McGinn-Noeth_Merger Experiments_supplement.pdf | 11-Jan-2005 16:04 | 233K | |
| Degryse-Laeven-Ongena_The Impact of Organzational Structure and Lending Technology on Banking Competition_supplement.pdf | 04-Nov-2008 10:30 | 97K | |
| Glaser-Langer_Framing_supplement.pdf | 14-Apr-2007 20:22 | 49K | |
| Luo-Luders-Deaves_supp-material_overconfidence.pdf | 27-Aug-2008 11:52 | 118K | |
| Maug-Rydqvis_sup-mat_Do Shareholders Vote Strategically.pdf | 18-Sep-2008 09:27 | 195K | |
| Sade-Schnitzlein-Zender_Divisible Good Auctions_supplement.pdf | 12-Jul-2006 17:18 | 615K | |